C17H16BrNO4 — CID 171352733
4-[(E)-2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-N-hydroxybenzamide (PubChem CID 171352733) has the molecular formula C17H16BrNO4 and a molecular weight of 378.22 g/mol. Its IUPAC name is 4-[(E)-2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-N-hydroxybenzamide.
| Compound Name | 4-[(E)-2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 171352733 |
| Molecular Formula | C17H16BrNO4 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 4-[(E)-2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-N-hydroxybenzamide |
| SMILES | COc1cc(Br)c(/C=C/c2ccc(C(=O)NO)cc2)cc1OC |
| InChI | InChI=1S/C17H16BrNO4/c1-22-15-9-13(14(18)10-16(15)23-2)8-5-11-3-6-12(7-4-11)17(20)19-21/h3-10,21H,1-2H3,(H,19,20)/b8-5+ |
| InChIKey | KJVSGEXYQFXTKC-VMPITWQZSA-N |
| XLogP | 3.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|