C19H18Br2O5 — CID 6000582
(E)-1,3-bis(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 6000582) has the molecular formula C19H18Br2O5 and a molecular weight of 486.16 g/mol. Its IUPAC name is (E)-1,3-bis(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6000582 |
| Molecular Formula | C19H18Br2O5 |
| Molecular Weight | 486.16 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | (E)-1,3-bis(2-bromo-4,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(Br)c(/C=C/C(=O)c2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C19H18Br2O5/c1-23-16-7-11(13(20)9-18(16)25-3)5-6-15(22)12-8-17(24-2)19(26-4)10-14(12)21/h5-10H,1-4H3/b6-5+ |
| InChIKey | MMOJMXAKPDLGNF-AATRIKPKSA-N |
| XLogP | 5.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|