C21H18BrFN2O3 — CID 76871089
3-(2-bromo-4,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 76871089) has the molecular formula C21H18BrFN2O3 and a molecular weight of 445.29 g/mol. Its IUPAC name is 3-(2-bromo-4,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | 3-(2-bromo-4,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 76871089 |
| Molecular Formula | C21H18BrFN2O3 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 3-(2-bromo-4,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | COc1cc(Br)c(C=CC(=O)c2cnn(-c3ccc(F)cc3)c2C)cc1OC |
| InChI | InChI=1S/C21H18BrFN2O3/c1-13-17(12-24-25(13)16-7-5-15(23)6-8-16)19(26)9-4-14-10-20(27-2)21(28-3)11-18(14)22/h4-12H,1-3H3 |
| InChIKey | ZUFVLYCQYOEORA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|