C19H13F3N2O — CID 60592039
(E)-3-(2,5-difluorophenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 60592039) has the molecular formula C19H13F3N2O and a molecular weight of 342.32 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 60592039 |
| Molecular Formula | C19H13F3N2O |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | Cc1c(C(=O)/C=C/c2cc(F)ccc2F)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13F3N2O/c1-12-17(11-23-24(12)16-6-3-14(20)4-7-16)19(25)9-2-13-10-15(21)5-8-18(13)22/h2-11H,1H3/b9-2+ |
| InChIKey | CPDYVJVGPJBUFM-XNWCZRBMSA-N |
| XLogP | 4.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|