C17H19BrN2O3 — CID 60602877
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 60602877) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60602877 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1cc(Br)c(/C=C/C(=O)c2cnn(C(C)C)c2)cc1OC |
| InChI | InChI=1S/C17H19BrN2O3/c1-11(2)20-10-13(9-19-20)15(21)6-5-12-7-16(22-3)17(23-4)8-14(12)18/h5-11H,1-4H3/b6-5+ |
| InChIKey | MGWYMYKQVABQPI-AATRIKPKSA-N |
| XLogP | 4.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|