C16H16BrNO2 — CID 13212553
N-benzyl-1-(2-bromo-4,5-dimethoxyphenyl)methanimine (PubChem CID 13212553) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-benzyl-1-(2-bromo-4,5-dimethoxyphenyl)methanimine.
| Compound Name | N-benzyl-1-(2-bromo-4,5-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 13212553 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-benzyl-1-(2-bromo-4,5-dimethoxyphenyl)methanimine |
| SMILES | COc1cc(Br)c(/C=N/Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C16H16BrNO2/c1-19-15-8-13(14(17)9-16(15)20-2)11-18-10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b18-11+ |
| InChIKey | HJBGIHVEAAXFLO-WOJGMQOQSA-N |
| XLogP | 4.09 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|