C28H38O5 — CID 101039108
4-[(E)-2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]-2,5-dipropoxybenzaldehyde (PubChem CID 101039108) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 4-[(E)-2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]-2,5-dipropoxybenzaldehyde.
| Compound Name | 4-[(E)-2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]-2,5-dipropoxybenzaldehyde |
|---|---|
| PubChem CID | 101039108 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-[(E)-2-(4-methyl-2,5-dipropoxyphenyl)ethenyl]-2,5-dipropoxybenzaldehyde |
| SMILES | CCCOc1cc(/C=C/c2cc(OCCC)c(C=O)cc2OCCC)c(OCCC)cc1C |
| InChI | InChI=1S/C28H38O5/c1-6-12-30-25-17-22(26(16-21(25)5)31-13-7-2)10-11-23-18-28(33-15-9-4)24(20-29)19-27(23)32-14-8-3/h10-11,16-20H,6-9,12-15H2,1-5H3/b11-10+ |
| InChIKey | GEBKEQUTKAZFRN-ZHACJKMWSA-N |
| XLogP | 7.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|