C29H42O2 — CID 58038590
1-decoxy-2-[(E)-2-(5-methoxy-2,4-dimethylphenyl)ethenyl]-4,5-dimethylbenzene (PubChem CID 58038590) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 1-decoxy-2-[(E)-2-(5-methoxy-2,4-dimethylphenyl)ethenyl]-4,5-dimethylbenzene.
| Compound Name | 1-decoxy-2-[(E)-2-(5-methoxy-2,4-dimethylphenyl)ethenyl]-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 58038590 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 1-decoxy-2-[(E)-2-(5-methoxy-2,4-dimethylphenyl)ethenyl]-4,5-dimethylbenzene |
| SMILES | CCCCCCCCCCOc1cc(C)c(C)cc1/C=C/c1cc(OC)c(C)cc1C |
| InChI | InChI=1S/C29H42O2/c1-7-8-9-10-11-12-13-14-17-31-29-20-23(3)22(2)19-27(29)16-15-26-21-28(30-6)25(5)18-24(26)4/h15-16,18-21H,7-14,17H2,1-6H3/b16-15+ |
| InChIKey | OWJJXPWMYHAAHC-FOCLMDBBSA-N |
| XLogP | 8.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|