C13H20O2 — CID 58371109
1-butoxy-4-methoxy-2,5-dimethylbenzene (PubChem CID 58371109) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-butoxy-4-methoxy-2,5-dimethylbenzene.
| Compound Name | 1-butoxy-4-methoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 58371109 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-butoxy-4-methoxy-2,5-dimethylbenzene |
| SMILES | CCCCOc1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C13H20O2/c1-5-6-7-15-13-9-10(2)12(14-4)8-11(13)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | RHUIMYZUTFJQGC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|