C40H56O6 — CID 10054806
2,7-dimethoxy-3,6,10,11-tetrapentoxytriphenylene (PubChem CID 10054806) has the molecular formula C40H56O6 and a molecular weight of 632.88 g/mol. Its IUPAC name is 2,7-dimethoxy-3,6,10,11-tetrapentoxytriphenylene.
| Compound Name | 2,7-dimethoxy-3,6,10,11-tetrapentoxytriphenylene |
|---|---|
| PubChem CID | 10054806 |
| Molecular Formula | C40H56O6 |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | 2,7-dimethoxy-3,6,10,11-tetrapentoxytriphenylene |
| SMILES | CCCCCOc1cc2c(cc1OC)c1cc(OCCCCC)c(OCCCCC)cc1c1cc(OC)c(OCCCCC)cc12 |
| InChI | InChI=1S/C40H56O6/c1-7-11-15-19-43-37-25-31-29(23-35(37)41-5)33-27-39(45-21-17-13-9-3)40(46-22-18-14-10-4)28-34(33)30-24-36(42-6)38(26-32(30)31)44-20-16-12-8-2/h23-28H,7-22H2,1-6H3 |
| InChIKey | VDTAAOICQFGHJQ-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|