C38H52O6 — CID 10031566
3,6,7,10-tetrapentoxytriphenylene-2,11-diol (PubChem CID 10031566) has the molecular formula C38H52O6 and a molecular weight of 604.83 g/mol. Its IUPAC name is 3,6,7,10-tetrapentoxytriphenylene-2,11-diol.
| Compound Name | 3,6,7,10-tetrapentoxytriphenylene-2,11-diol |
|---|---|
| PubChem CID | 10031566 |
| Molecular Formula | C38H52O6 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 3,6,7,10-tetrapentoxytriphenylene-2,11-diol |
| SMILES | CCCCCOc1cc2c(cc1O)c1cc(O)c(OCCCCC)cc1c1cc(OCCCCC)c(OCCCCC)cc21 |
| InChI | InChI=1S/C38H52O6/c1-5-9-13-17-41-35-23-29-27(21-33(35)39)28-22-34(40)36(42-18-14-10-6-2)24-30(28)32-26-38(44-20-16-12-8-4)37(25-31(29)32)43-19-15-11-7-3/h21-26,39-40H,5-20H2,1-4H3 |
| InChIKey | XKKVVMBWMQVDAG-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|