C42H62O6Si — CID 10327305
3,6,10-tripentoxy-7-tri(propan-2-yl)silyloxytriphenylene-2,11-diol (PubChem CID 10327305) has the molecular formula C42H62O6Si and a molecular weight of 691.04 g/mol. Its IUPAC name is 3,6,10-tripentoxy-7-tri(propan-2-yl)silyloxytriphenylene-2,11-diol.
| Compound Name | 3,6,10-tripentoxy-7-tri(propan-2-yl)silyloxytriphenylene-2,11-diol |
|---|---|
| PubChem CID | 10327305 |
| Molecular Formula | C42H62O6Si |
| Molecular Weight | 691.04 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | 3,6,10-tripentoxy-7-tri(propan-2-yl)silyloxytriphenylene-2,11-diol |
| SMILES | CCCCCOc1cc2c(cc1O)c1cc(O)c(OCCCCC)cc1c1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(OCCCCC)cc21 |
| InChI | InChI=1S/C42H62O6Si/c1-10-13-16-19-45-39-24-33-31(22-37(39)43)32-23-38(44)40(46-20-17-14-11-2)25-34(32)36-27-42(41(26-35(33)36)47-21-18-15-12-3)48-49(28(4)5,29(6)7)30(8)9/h22-30,43-44H,10-21H2,1-9H3 |
| InChIKey | XWIXDPLKNSUBQQ-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.04 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|