C45H66O8 — CID 71318088
acetic acid;3,6,7,10,11-pentapentoxytriphenylen-2-ol (PubChem CID 71318088) has the molecular formula C45H66O8 and a molecular weight of 735.01 g/mol. Its IUPAC name is acetic acid;3,6,7,10,11-pentapentoxytriphenylen-2-ol.
| Compound Name | acetic acid;3,6,7,10,11-pentapentoxytriphenylen-2-ol |
|---|---|
| PubChem CID | 71318088 |
| Molecular Formula | C45H66O8 |
| Molecular Weight | 735.01 g/mol |
| Exact Mass | 734.48 |
| IUPAC Name | acetic acid;3,6,7,10,11-pentapentoxytriphenylen-2-ol |
| SMILES | CC(=O)O.CCCCCOc1cc2c(cc1O)c1cc(OCCCCC)c(OCCCCC)cc1c1cc(OCCCCC)c(OCCCCC)cc21 |
| InChI | InChI=1S/C43H62O6.C2H4O2/c1-6-11-16-21-45-39-27-33-32(26-38(39)44)34-28-40(46-22-17-12-7-2)42(48-24-19-14-9-4)30-36(34)37-31-43(49-25-20-15-10-5)41(29-35(33)37)47-23-18-13-8-3;1-2(3)4/h26-31,44H,6-25H2,1-5H3;1H3,(H,3,4) |
| InChIKey | IDAHCBVZCNIYFD-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.01 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|