C15H20O4 — CID 82552278
ethyl 2-(2,5-dimethyl-4-propoxyphenyl)-2-oxoacetate (PubChem CID 82552278) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethyl-4-propoxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2,5-dimethyl-4-propoxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 82552278 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl 2-(2,5-dimethyl-4-propoxyphenyl)-2-oxoacetate |
| SMILES | CCCOc1cc(C)c(C(=O)C(=O)OCC)cc1C |
| InChI | InChI=1S/C15H20O4/c1-5-7-19-13-9-10(3)12(8-11(13)4)14(16)15(17)18-6-2/h8-9H,5-7H2,1-4H3 |
| InChIKey | OYAIDJIOBCWIKJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|