C16H20O4 — CID 82552294
methyl (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoate (PubChem CID 82552294) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 82552294 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoate |
| SMILES | CCCOc1cc(C)c(C(=O)/C=C/C(=O)OC)cc1C |
| InChI | InChI=1S/C16H20O4/c1-5-8-20-15-10-11(2)13(9-12(15)3)14(17)6-7-16(18)19-4/h6-7,9-10H,5,8H2,1-4H3/b7-6+ |
| InChIKey | YPUIVNUVZBPPTK-VOTSOKGWSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|