C16H24O2S — CID 82053582
1-(2,5-dimethyl-4-propoxyphenyl)-2-propylsulfanylethanone (PubChem CID 82053582) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-(2,5-dimethyl-4-propoxyphenyl)-2-propylsulfanylethanone.
| Compound Name | 1-(2,5-dimethyl-4-propoxyphenyl)-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 82053582 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(2,5-dimethyl-4-propoxyphenyl)-2-propylsulfanylethanone |
| SMILES | CCCOc1cc(C)c(C(=O)CSCCC)cc1C |
| InChI | InChI=1S/C16H24O2S/c1-5-7-18-16-10-12(3)14(9-13(16)4)15(17)11-19-8-6-2/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | VBALTYINKIPBKK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|