C14H20OS — CID 43802074
2-propylsulfanyl-1-(2,4,5-trimethylphenyl)ethanone (PubChem CID 43802074) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-propylsulfanyl-1-(2,4,5-trimethylphenyl)ethanone.
| Compound Name | 2-propylsulfanyl-1-(2,4,5-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 43802074 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-propylsulfanyl-1-(2,4,5-trimethylphenyl)ethanone |
| SMILES | CCCSCC(=O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C14H20OS/c1-5-6-16-9-14(15)13-8-11(3)10(2)7-12(13)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | OZHKLSKDJXQEHQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|