C15H22O2S — CID 82053584
1-(2,5-dimethyl-4-propoxyphenyl)-2-ethylsulfanylethanone (PubChem CID 82053584) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-(2,5-dimethyl-4-propoxyphenyl)-2-ethylsulfanylethanone.
| Compound Name | 1-(2,5-dimethyl-4-propoxyphenyl)-2-ethylsulfanylethanone |
|---|---|
| PubChem CID | 82053584 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-(2,5-dimethyl-4-propoxyphenyl)-2-ethylsulfanylethanone |
| SMILES | CCCOc1cc(C)c(C(=O)CSCC)cc1C |
| InChI | InChI=1S/C15H22O2S/c1-5-7-17-15-9-11(3)13(8-12(15)4)14(16)10-18-6-2/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | KEOFEZHOZQVBRZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |