C12H17NO2 — CID 82048712
2-amino-1-(4-ethoxy-2,5-dimethylphenyl)ethanone (PubChem CID 82048712) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-amino-1-(4-ethoxy-2,5-dimethylphenyl)ethanone.
| Compound Name | 2-amino-1-(4-ethoxy-2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 82048712 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-amino-1-(4-ethoxy-2,5-dimethylphenyl)ethanone |
| SMILES | CCOc1cc(C)c(C(=O)CN)cc1C |
| InChI | InChI=1S/C12H17NO2/c1-4-15-12-6-8(2)10(5-9(12)3)11(14)7-13/h5-6H,4,7,13H2,1-3H3 |
| InChIKey | YKEARWKYHCYWOR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |