C13H18O3 — CID 82552309
ethyl 4-ethoxy-2,5-dimethylbenzoate (PubChem CID 82552309) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is ethyl 4-ethoxy-2,5-dimethylbenzoate.
| Compound Name | ethyl 4-ethoxy-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 82552309 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | ethyl 4-ethoxy-2,5-dimethylbenzoate |
| SMILES | CCOC(=O)c1cc(C)c(OCC)cc1C |
| InChI | InChI=1S/C13H18O3/c1-5-15-12-8-9(3)11(7-10(12)4)13(14)16-6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | WWSBGBPSGUDQBE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |