(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid

C15H18O4 — CID 82053552

IUPAC(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid
SMILESCCCOc1cc(C)c(C(=O)/C=C/C(=O)O)cc1C
InChIInChI=1S/C15H18O4/c1-4-7-19-14-9-10(2)12(8-11(14)3)13(16)5-6-15(17)18/h5-6,8-9H,4,7H2,1-3H3,(H,17,18)/b6-5+
InChIKeyKHKVAINIHGJNFP-AATRIKPKSA-N
MW262.30 g/mol
LogP2.92
Rot. Bonds6

About (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid

(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 82053552) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid
PubChem CID82053552
Molecular FormulaC15H18O4
Molecular Weight262.30 g/mol
Exact Mass262.12
IUPAC Name(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid
SMILESCCCOc1cc(C)c(C(=O)/C=C/C(=O)O)cc1C
InChIInChI=1S/C15H18O4/c1-4-7-19-14-9-10(2)12(8-11(14)3)13(16)5-6-15(17)18/h5-6,8-9H,4,7H2,1-3H3,(H,17,18)/b6-5+
InChIKeyKHKVAINIHGJNFP-AATRIKPKSA-N
XLogP2.92
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.30
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid (CID 82053552) is (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid is CCCOc1cc(C)c(C(=O)/C=C/C(=O)O)cc1C.
What is the InChIKey of (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid?
The InChIKey is KHKVAINIHGJNFP-AATRIKPKSA-N. The full InChI is InChI=1S/C15H18O4/c1-4-7-19-14-9-10(2)12(8-11(14)3)13(16)5-6-15(17)18/h5-6,8-9H,4,7H2,1-3H3,(H,17,18)/b6-5+.
What are the key properties of (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid?
(E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid has a molecular weight of 262.30 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,5-dimethyl-4-propoxyphenyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 82053552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).