(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid

C16H19ClO5 — CID 82551618

IUPAC(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid
SMILESCCCOc1cc(C(=O)/C=C/C(=O)O)c(OCCC)cc1Cl
InChIInChI=1S/C16H19ClO5/c1-3-7-21-14-10-12(17)15(22-8-4-2)9-11(14)13(18)5-6-16(19)20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,19,20)/b6-5+
InChIKeyJIGKCQLCJISGIC-AATRIKPKSA-N
MW326.78 g/mol
LogP3.74
Rot. Bonds9

About (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid

(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 82551618) has the molecular formula C16H19ClO5 and a molecular weight of 326.78 g/mol. Its IUPAC name is (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid
PubChem CID82551618
Molecular FormulaC16H19ClO5
Molecular Weight326.78 g/mol
Exact Mass326.09
IUPAC Name(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid
SMILESCCCOc1cc(C(=O)/C=C/C(=O)O)c(OCCC)cc1Cl
InChIInChI=1S/C16H19ClO5/c1-3-7-21-14-10-12(17)15(22-8-4-2)9-11(14)13(18)5-6-16(19)20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,19,20)/b6-5+
InChIKeyJIGKCQLCJISGIC-AATRIKPKSA-N
XLogP3.74
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.78
LogP ≤ 53.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid (CID 82551618) is (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid is CCCOc1cc(C(=O)/C=C/C(=O)O)c(OCCC)cc1Cl.
What is the InChIKey of (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid?
The InChIKey is JIGKCQLCJISGIC-AATRIKPKSA-N. The full InChI is InChI=1S/C16H19ClO5/c1-3-7-21-14-10-12(17)15(22-8-4-2)9-11(14)13(18)5-6-16(19)20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,19,20)/b6-5+.
What are the key properties of (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid?
(E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid has a molecular weight of 326.78 g/mol, XLogP of 3.74, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(4-chloro-2,5-dipropoxyphenyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 82551618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).