C13H11Cl3O4 — CID 91716972
1-O-propyl 4-O-(2,4,5-trichlorophenyl) (E)-but-2-enedioate (PubChem CID 91716972) has the molecular formula C13H11Cl3O4 and a molecular weight of 337.59 g/mol. Its IUPAC name is 1-O-propyl 4-O-(2,4,5-trichlorophenyl) (E)-but-2-enedioate.
| Compound Name | 1-O-propyl 4-O-(2,4,5-trichlorophenyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91716972 |
| Molecular Formula | C13H11Cl3O4 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 1-O-propyl 4-O-(2,4,5-trichlorophenyl) (E)-but-2-enedioate |
| SMILES | CCCOC(=O)/C=C/C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3O4/c1-2-5-19-12(17)3-4-13(18)20-11-7-9(15)8(14)6-10(11)16/h3-4,6-7H,2,5H2,1H3/b4-3+ |
| InChIKey | CFQPOUXSYAHDSJ-ONEGZZNKSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|