C15H14Cl4O4 — CID 91725240
1-O-pentyl 4-O-(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate (PubChem CID 91725240) has the molecular formula C15H14Cl4O4 and a molecular weight of 400.09 g/mol. Its IUPAC name is 1-O-pentyl 4-O-(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate.
| Compound Name | 1-O-pentyl 4-O-(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91725240 |
| Molecular Formula | C15H14Cl4O4 |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 1-O-pentyl 4-O-(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate |
| SMILES | CCCCCOC(=O)/C=C/C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H14Cl4O4/c1-2-3-4-7-22-11(20)5-6-12(21)23-15-10(17)8-9(16)13(18)14(15)19/h5-6,8H,2-4,7H2,1H3/b6-5+ |
| InChIKey | JHGVKYBIGKRNCD-AATRIKPKSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|