C16H4Cl8O4 — CID 91742133
bis(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate (PubChem CID 91742133) has the molecular formula C16H4Cl8O4 and a molecular weight of 543.83 g/mol. Its IUPAC name is bis(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate.
| Compound Name | bis(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91742133 |
| Molecular Formula | C16H4Cl8O4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 539.76 |
| IUPAC Name | bis(2,3,4,6-tetrachlorophenyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1Cl)Oc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H4Cl8O4/c17-5-3-7(19)15(13(23)11(5)21)27-9(25)1-2-10(26)28-16-8(20)4-6(18)12(22)14(16)24/h1-4H/b2-1+ |
| InChIKey | XXEKWCKUIYKCMN-OWOJBTEDSA-N |
| XLogP | 7.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|