C17H10Cl6O4 — CID 95559504
[2-[(2-acetyloxy-3,5,6-trichlorophenyl)methyl]-3,4,6-trichlorophenyl] acetate (PubChem CID 95559504) has the molecular formula C17H10Cl6O4 and a molecular weight of 490.98 g/mol. Its IUPAC name is [2-[(2-acetyloxy-3,5,6-trichlorophenyl)methyl]-3,4,6-trichlorophenyl] acetate.
| Compound Name | [2-[(2-acetyloxy-3,5,6-trichlorophenyl)methyl]-3,4,6-trichlorophenyl] acetate |
|---|---|
| PubChem CID | 95559504 |
| Molecular Formula | C17H10Cl6O4 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 487.87 |
| IUPAC Name | [2-[(2-acetyloxy-3,5,6-trichlorophenyl)methyl]-3,4,6-trichlorophenyl] acetate |
| SMILES | CC(=O)Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(Cl)c(Cl)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C17H10Cl6O4/c1-6(24)26-16-8(14(22)10(18)4-12(16)20)3-9-15(23)11(19)5-13(21)17(9)27-7(2)25/h4-5H,3H2,1-2H3 |
| InChIKey | WAAFKFLTOKGWCN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|