About (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate
(2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (PubChem CID 91715827) has the molecular formula C13H10Cl3NO3
and a molecular weight of 334.59 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
Molecular Properties
| Compound Name | (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| PubChem CID | 91715827 |
| Molecular Formula | C13H10Cl3NO3 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| SMILES | C=CCNC(=O)/C=C/C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO3/c1-2-5-17-11(18)3-4-12(19)20-13-9(15)6-8(14)7-10(13)16/h2-4,6-7H,1,5H2,(H,17,18)/b4-3+ |
| InChIKey | DFLOCRBWCZQWAR-ONEGZZNKSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The IUPAC name of (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (CID 91715827) is (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
What is the SMILES notation for (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The canonical SMILES for (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate is C=CCNC(=O)/C=C/C(=O)Oc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The InChIKey is DFLOCRBWCZQWAR-ONEGZZNKSA-N. The full InChI is InChI=1S/C13H10Cl3NO3/c1-2-5-17-11(18)3-4-12(19)20-13-9(15)6-8(14)7-10(13)16/h2-4,6-7H,1,5H2,(H,17,18)/b4-3+.
What are the key properties of (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
(2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate has a molecular weight of 334.59 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate is sourced from PubChem (CID 91715827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).