C13H10Cl3NO3 — CID 91715827
(2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (PubChem CID 91715827) has the molecular formula C13H10Cl3NO3 and a molecular weight of 334.59 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
| Compound Name | (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
|---|---|
| PubChem CID | 91715827 |
| Molecular Formula | C13H10Cl3NO3 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | (2,4,6-trichlorophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| SMILES | C=CCNC(=O)/C=C/C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO3/c1-2-5-17-11(18)3-4-12(19)20-13-9(15)6-8(14)7-10(13)16/h2-4,6-7H,1,5H2,(H,17,18)/b4-3+ |
| InChIKey | DFLOCRBWCZQWAR-ONEGZZNKSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|