C11H12Cl3NO — CID 21286525
N-[2-(2,4,6-trichlorophenoxy)ethyl]prop-2-en-1-amine (PubChem CID 21286525) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is N-[2-(2,4,6-trichlorophenoxy)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 21286525 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl3NO/c1-2-3-15-4-5-16-11-9(13)6-8(12)7-10(11)14/h2,6-7,15H,1,3-5H2 |
| InChIKey | NYXJADFKWSEYII-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|