About (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate
(4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (PubChem CID 91715826) has the molecular formula C13H12BrNO3
and a molecular weight of 310.15 g/mol. Its IUPAC name is (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
Molecular Properties
| Compound Name | (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| PubChem CID | 91715826 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate |
| SMILES | C=CCNC(=O)/C=C/C(=O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H12BrNO3/c1-2-9-15-12(16)7-8-13(17)18-11-5-3-10(14)4-6-11/h2-8H,1,9H2,(H,15,16)/b8-7+ |
| InChIKey | KNHGDANWWLGUKN-BQYQJAHWSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The IUPAC name of (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate (CID 91715826) is (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate.
What is the SMILES notation for (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The canonical SMILES for (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate is C=CCNC(=O)/C=C/C(=O)Oc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
The InChIKey is KNHGDANWWLGUKN-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H12BrNO3/c1-2-9-15-12(16)7-8-13(17)18-11-5-3-10(14)4-6-11/h2-8H,1,9H2,(H,15,16)/b8-7+.
What are the key properties of (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate?
(4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate has a molecular weight of 310.15 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) (E)-4-oxo-4-(prop-2-enylamino)but-2-enoate is sourced from PubChem (CID 91715826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).