C14H12BrNO2 — CID 51370786
(E)-3-(5-bromo-1-benzofuran-2-yl)-N-prop-2-enylprop-2-enamide (PubChem CID 51370786) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is (E)-3-(5-bromo-1-benzofuran-2-yl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-(5-bromo-1-benzofuran-2-yl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 51370786 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (E)-3-(5-bromo-1-benzofuran-2-yl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C=C/c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C14H12BrNO2/c1-2-7-16-14(17)6-4-12-9-10-8-11(15)3-5-13(10)18-12/h2-6,8-9H,1,7H2,(H,16,17)/b6-4+ |
| InChIKey | ZAAHINVTCBDFJT-GQCTYLIASA-N |
| XLogP | 3.51 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|