C23H14BrNO7 — CID 19186673
[2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 6-bromo-2-oxochromene-3-carboxylate (PubChem CID 19186673) has the molecular formula C23H14BrNO7 and a molecular weight of 496.27 g/mol. Its IUPAC name is [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 6-bromo-2-oxochromene-3-carboxylate.
| Compound Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 6-bromo-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19186673 |
| Molecular Formula | C23H14BrNO7 |
| Molecular Weight | 496.27 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 6-bromo-2-oxochromene-3-carboxylate |
| SMILES | C=CCNC(=O)c1cc2ccc(OC(=O)c3cc4cc(Br)ccc4oc3=O)cc2oc1=O |
| InChI | InChI=1S/C23H14BrNO7/c1-2-7-25-20(26)16-9-12-3-5-15(11-19(12)32-21(16)27)30-22(28)17-10-13-8-14(24)4-6-18(13)31-23(17)29/h2-6,8-11H,1,7H2,(H,25,26) |
| InChIKey | XELHGAJIGVSZIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|