C24H23NO5 — CID 19185967
[2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 4-tert-butylbenzoate (PubChem CID 19185967) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 4-tert-butylbenzoate.
| Compound Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 19185967 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] 4-tert-butylbenzoate |
| SMILES | C=CCNC(=O)c1cc2ccc(OC(=O)c3ccc(C(C)(C)C)cc3)cc2oc1=O |
| InChI | InChI=1S/C24H23NO5/c1-5-12-25-21(26)19-13-16-8-11-18(14-20(16)30-23(19)28)29-22(27)15-6-9-17(10-7-15)24(2,3)4/h5-11,13-14H,1,12H2,2-4H3,(H,25,26) |
| InChIKey | OQOOEFMLLQWSOG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|