C32H33NO6 — CID 19187357
[2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 4-(4-tert-butylphenoxy)butanoate (PubChem CID 19187357) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 4-(4-tert-butylphenoxy)butanoate.
| Compound Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 4-(4-tert-butylphenoxy)butanoate |
|---|---|
| PubChem CID | 19187357 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 4-(4-tert-butylphenoxy)butanoate |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Oc2ccc3cc(C(=O)NCCc4ccccc4)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C32H33NO6/c1-32(2,3)24-12-15-25(16-13-24)37-19-7-10-29(34)38-26-14-11-23-20-27(31(36)39-28(23)21-26)30(35)33-18-17-22-8-5-4-6-9-22/h4-6,8-9,11-16,20-21H,7,10,17-19H2,1-3H3,(H,33,35) |
| InChIKey | NYQVJVAAROMDDX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|