C32H28N2O7 — CID 19187487
[2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 19187487) has the molecular formula C32H28N2O7 and a molecular weight of 552.58 g/mol. Its IUPAC name is [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 19187487 |
| Molecular Formula | C32H28N2O7 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | [2-oxo-3-(2-phenylethylcarbamoyl)chromen-7-yl] 6-(1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Oc1ccc2cc(C(=O)NCCc3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C32H28N2O7/c35-28(13-5-2-8-18-34-30(37)24-11-6-7-12-25(24)31(34)38)40-23-15-14-22-19-26(32(39)41-27(22)20-23)29(36)33-17-16-21-9-3-1-4-10-21/h1,3-4,6-7,9-12,14-15,19-20H,2,5,8,13,16-18H2,(H,33,36) |
| InChIKey | IAYAUEGHTZLSPB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|