C30H24N2O7 — CID 19187459
[2-oxo-3-(propan-2-ylcarbamoyl)chromen-7-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 19187459) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is [2-oxo-3-(propan-2-ylcarbamoyl)chromen-7-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [2-oxo-3-(propan-2-ylcarbamoyl)chromen-7-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 19187459 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [2-oxo-3-(propan-2-ylcarbamoyl)chromen-7-yl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | CC(C)NC(=O)c1cc2ccc(OC(=O)C(Cc3ccccc3)N3C(=O)c4ccccc4C3=O)cc2oc1=O |
| InChI | InChI=1S/C30H24N2O7/c1-17(2)31-26(33)23-15-19-12-13-20(16-25(19)39-29(23)36)38-30(37)24(14-18-8-4-3-5-9-18)32-27(34)21-10-6-7-11-22(21)28(32)35/h3-13,15-17,24H,14H2,1-2H3,(H,31,33) |
| InChIKey | NBKWTFFKKZTZRY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|