C18H21NO5 — CID 19185670
[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-methylpropanoate (PubChem CID 19185670) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-methylpropanoate.
| Compound Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 19185670 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-methylpropanoate |
| SMILES | CC(C)CNC(=O)c1cc2ccc(OC(=O)C(C)C)cc2oc1=O |
| InChI | InChI=1S/C18H21NO5/c1-10(2)9-19-16(20)14-7-12-5-6-13(23-17(21)11(3)4)8-15(12)24-18(14)22/h5-8,10-11H,9H2,1-4H3,(H,19,20) |
| InChIKey | BBIBLPHBPFPVNY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|