C28H28N2O6 — CID 19186599
[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoate (PubChem CID 19186599) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoate.
| Compound Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19186599 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-butoxyphenyl)-2-cyanoprop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C(\C#N)C(=O)Oc2ccc3cc(C(=O)NCC(C)C)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C28H28N2O6/c1-4-5-12-34-22-9-6-19(7-10-22)13-21(16-29)27(32)35-23-11-8-20-14-24(26(31)30-17-18(2)3)28(33)36-25(20)15-23/h6-11,13-15,18H,4-5,12,17H2,1-3H3,(H,30,31)/b21-13+ |
| InChIKey | ROIHNNQIVLABRP-FYJGNVAPSA-N |
| XLogP | 4.87 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|