C16H17NO6 — CID 20993682
2-[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl]oxyacetic acid (PubChem CID 20993682) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl]oxyacetic acid.
| Compound Name | 2-[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl]oxyacetic acid |
|---|---|
| PubChem CID | 20993682 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl]oxyacetic acid |
| SMILES | CC(C)CNC(=O)c1cc2ccc(OCC(=O)O)cc2oc1=O |
| InChI | InChI=1S/C16H17NO6/c1-9(2)7-17-15(20)12-5-10-3-4-11(22-8-14(18)19)6-13(10)23-16(12)21/h3-6,9H,7-8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | FZJUSKQEYJKHKC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|