C27H31NO6 — CID 19186968
[3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-(2-tert-butyl-4-methylphenoxy)acetate (PubChem CID 19186968) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-(2-tert-butyl-4-methylphenoxy)acetate.
| Compound Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-(2-tert-butyl-4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19186968 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | [3-(2-methylpropylcarbamoyl)-2-oxochromen-7-yl] 2-(2-tert-butyl-4-methylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)Oc2ccc3cc(C(=O)NCC(C)C)c(=O)oc3c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H31NO6/c1-16(2)14-28-25(30)20-12-18-8-9-19(13-23(18)34-26(20)31)33-24(29)15-32-22-10-7-17(3)11-21(22)27(4,5)6/h7-13,16H,14-15H2,1-6H3,(H,28,30) |
| InChIKey | FHFUJIIXGCPAAM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|