C23H23NO6 — CID 19186877
[3-(ethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 19186877) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [3-(ethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [3-(ethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19186877 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [3-(ethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CCNC(=O)c1cc2ccc(OC(=O)COc3ccc(C(C)C)cc3)cc2oc1=O |
| InChI | InChI=1S/C23H23NO6/c1-4-24-22(26)19-11-16-7-10-18(12-20(16)30-23(19)27)29-21(25)13-28-17-8-5-15(6-9-17)14(2)3/h5-12,14H,4,13H2,1-3H3,(H,24,26) |
| InChIKey | QENWIXZQNCJOOF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|