C23H23NO8 — CID 19187537
[3-(2-methoxyethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-ethoxyphenoxy)acetate (PubChem CID 19187537) has the molecular formula C23H23NO8 and a molecular weight of 441.44 g/mol. Its IUPAC name is [3-(2-methoxyethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-ethoxyphenoxy)acetate.
| Compound Name | [3-(2-methoxyethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 19187537 |
| Molecular Formula | C23H23NO8 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [3-(2-methoxyethylcarbamoyl)-2-oxochromen-7-yl] 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)Oc2ccc3cc(C(=O)NCCOC)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C23H23NO8/c1-3-29-16-6-8-17(9-7-16)30-14-21(25)31-18-5-4-15-12-19(22(26)24-10-11-28-2)23(27)32-20(15)13-18/h4-9,12-13H,3,10-11,14H2,1-2H3,(H,24,26) |
| InChIKey | KJFKTSOLOYTKMW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|