C24H25NO6 — CID 19187271
[2-oxo-3-(propylcarbamoyl)chromen-7-yl] 2-(3-propan-2-ylphenoxy)acetate (PubChem CID 19187271) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 2-(3-propan-2-ylphenoxy)acetate.
| Compound Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 2-(3-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 19187271 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] 2-(3-propan-2-ylphenoxy)acetate |
| SMILES | CCCNC(=O)c1cc2ccc(OC(=O)COc3cccc(C(C)C)c3)cc2oc1=O |
| InChI | InChI=1S/C24H25NO6/c1-4-10-25-23(27)20-12-17-8-9-19(13-21(17)31-24(20)28)30-22(26)14-29-18-7-5-6-16(11-18)15(2)3/h5-9,11-13,15H,4,10,14H2,1-3H3,(H,25,27) |
| InChIKey | FVTHTOCRLTUFNK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|