C22H20BrNO6 — CID 19180582
[3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(2-bromophenoxy)acetate (PubChem CID 19180582) has the molecular formula C22H20BrNO6 and a molecular weight of 474.31 g/mol. Its IUPAC name is [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(2-bromophenoxy)acetate.
| Compound Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(2-bromophenoxy)acetate |
|---|---|
| PubChem CID | 19180582 |
| Molecular Formula | C22H20BrNO6 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(2-bromophenoxy)acetate |
| SMILES | CCCCNC(=O)c1cc2ccc(OC(=O)COc3ccccc3Br)cc2oc1=O |
| InChI | InChI=1S/C22H20BrNO6/c1-2-3-10-24-21(26)16-11-14-8-9-15(12-19(14)30-22(16)27)29-20(25)13-28-18-7-5-4-6-17(18)23/h4-9,11-12H,2-3,10,13H2,1H3,(H,24,26) |
| InChIKey | JUJBBJSZMXHIKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|