C23H22ClNO6 — CID 19180581
[3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 19180581) has the molecular formula C23H22ClNO6 and a molecular weight of 443.88 g/mol. Its IUPAC name is [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19180581 |
| Molecular Formula | C23H22ClNO6 |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | CCCCNC(=O)c1cc2ccc(OC(=O)COc3ccc(Cl)cc3C)cc2oc1=O |
| InChI | InChI=1S/C23H22ClNO6/c1-3-4-9-25-22(27)18-11-15-5-7-17(12-20(15)31-23(18)28)30-21(26)13-29-19-8-6-16(24)10-14(19)2/h5-8,10-12H,3-4,9,13H2,1-2H3,(H,25,27) |
| InChIKey | NVWWNVIMBITOFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|