C19H23NO5 — CID 19185199
[3-(butylcarbamoyl)-2-oxochromen-7-yl] pentanoate (PubChem CID 19185199) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [3-(butylcarbamoyl)-2-oxochromen-7-yl] pentanoate.
| Compound Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] pentanoate |
|---|---|
| PubChem CID | 19185199 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] pentanoate |
| SMILES | CCCCNC(=O)c1cc2ccc(OC(=O)CCCC)cc2oc1=O |
| InChI | InChI=1S/C19H23NO5/c1-3-5-7-17(21)24-14-9-8-13-11-15(18(22)20-10-6-4-2)19(23)25-16(13)12-14/h8-9,11-12H,3-7,10H2,1-2H3,(H,20,22) |
| InChIKey | DITXGHCFHAZUNW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|