C27H29NO7 — CID 19185246
[3-(butylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 19185246) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is [3-(butylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19185246 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [3-(butylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCCCNC(=O)c1cc2ccc(OC(=O)/C=C/c3ccc(OCC)c(OCC)c3)cc2oc1=O |
| InChI | InChI=1S/C27H29NO7/c1-4-7-14-28-26(30)21-16-19-10-11-20(17-23(19)35-27(21)31)34-25(29)13-9-18-8-12-22(32-5-2)24(15-18)33-6-3/h8-13,15-17H,4-7,14H2,1-3H3,(H,28,30)/b13-9+ |
| InChIKey | FFKWEJLHRCVBAX-UKTHLTGXSA-N |
| XLogP | 4.74 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|