C26H21NO7 — CID 19182022
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 19182022) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19182022 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)Oc2ccc3cc(C(=O)NCc4ccco4)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C26H21NO7/c1-2-31-19-9-5-17(6-10-19)7-12-24(28)33-20-11-8-18-14-22(26(30)34-23(18)15-20)25(29)27-16-21-4-3-13-32-21/h3-15H,2,16H2,1H3,(H,27,29)/b12-7+ |
| InChIKey | CSFBUJFUDOAMPP-KPKJPENVSA-N |
| XLogP | 4.33 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|