C33H27NO8 — CID 19185243
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 19185243) has the molecular formula C33H27NO8 and a molecular weight of 565.58 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19185243 |
| Molecular Formula | C33H27NO8 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc3cc(C(=O)NCc4ccco4)c(=O)oc3c2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C33H27NO8/c1-21-6-3-4-7-24(21)20-40-28-13-9-22(16-30(28)38-2)10-14-31(35)41-25-12-11-23-17-27(33(37)42-29(23)18-25)32(36)34-19-26-8-5-15-39-26/h3-18H,19-20H2,1-2H3,(H,34,36)/b14-10+ |
| InChIKey | YTONAIRHNQGZGE-GXDHUFHOSA-N |
| XLogP | 5.83 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|