C20H19NO6 — CID 19182034
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 19182034) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 19182034 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2cc(C(=O)NCc3ccco3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H19NO6/c1-20(2,3)19(24)26-13-7-6-12-9-15(18(23)27-16(12)10-13)17(22)21-11-14-5-4-8-25-14/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | LWBAYSBINKKDOG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|