C20H13NO6S — CID 19185223
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] thiophene-2-carboxylate (PubChem CID 19185223) has the molecular formula C20H13NO6S and a molecular weight of 395.39 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19185223 |
| Molecular Formula | C20H13NO6S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc2cc(C(=O)NCc3ccco3)c(=O)oc2c1)c1cccs1 |
| InChI | InChI=1S/C20H13NO6S/c22-18(21-11-14-3-1-7-25-14)15-9-12-5-6-13(10-16(12)27-19(15)23)26-20(24)17-4-2-8-28-17/h1-10H,11H2,(H,21,22) |
| InChIKey | MYWKWZJDUNAMIK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|